<p>CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 1 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: isobutyl bromide 1-chloropentane</p><p>1,2-dibromobutane 1,4-dibromo-2,3-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 3,4-dichloro-2,2,-dimethylhexane 1,3-dibromo-2,3-dimethylpentane</p><p>4. Write a correct name for each compound:</p><p>CH2Cl CH3 Br CH3 CH2 CH2 Cl H H CH2 H CH3 H C C C C C H H C C C C H H Br H H CH3 Br Cl CH CH3 3</p><p>Cl CH2ClCH2CBrCH3C(CH3)2CHBrCH2CH3 Br Br</p><p>Cl Br</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 2 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: sec-butyl bromide 2-chloropentane</p><p>1,3-dibromobutane 2,4-dibromo-1,3-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 2,2-dichloro-3,4,-dimethylhexane 2-methyl-2,3,3-tribromopentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 Br H H H Cl CH2 H C C C C C H CH2 H CH3 H Br H H H C C C C H CH2 Cl H CH2 CH CH2Cl 3 Br</p><p>Br Br CH2BrCH2CBr(C2H5)CHCH2ClCH3 Cl</p><p>Br Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 3 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: n-butyl bromide 3-chloropentane</p><p>1,2-dibromohexane 1,3-dibromo-2,4-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 2,4-dichloro-3,3,-dimethylhexane 1,5-dibromo-2,4-dimethylpentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 Br H H H CH2 H H CH3 Br C C C C C H H C C C C H H Cl H H Br H H CHBr CH2 CH3 CH2Cl</p><p>Br Cl (CH3)2CBrCHCH3CHClC(CH2Br)2CH3 Br</p><p>Cl Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 4 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: isopropyl bromide 1-chloroheptane</p><p>2,3-dibromohexane 1,2-dibromo-3,4-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 1,3-dichloro-2,2,-dimethylhexane 3-methyl-1,2,2-tribromopentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 Br CHCl CH2 H H H CH2 H CH2Cl H C C C C H H C C C C H H Cl H H Br H CH CH2Br 2 CH3</p><p>Br (CH3)2CBrCH2CHCH2BrCHCH3CHClCH3 Cl Br Cl Br</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 5 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: n-propyl bromide 2-chloroheptane</p><p>1,3-dibromohexane 1,4-dibromo-2,3-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 1,5-dichloro-2,3,-dimethylhexane 1,3-dibromo-2,3-dimethylpentane</p><p>4. Write a correct name for each compound:</p><p>CH2Cl CH3 Cl CH3 CH2 CH2 Cl H H CH2 H CH2Cl H C C C C C H Br C C C C H H Br H H Br H H CH CH3 3</p><p>Br CH2ClCH2CBrCH3C(CH3)2CHBrCH2CH3 Cl</p><p>Br Br</p><p>Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 6 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: isobutyl bromide 3-chloroheptane</p><p>1,4-dibromohexane 2,4-dibromo-1,3-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 3,4-dichloro-2,2,-dimethylhexane 2-methyl-2,3,3-tribromopentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 Br H H H Br CH2 H C C C C C H CH2 H CH3 H Br H H H C C C C H CH2 CH3 Br Cl CH3 CH2Cl</p><p>Cl CH2BrCH2CBr(C2H5)CHCH2ClCH3 Br Br</p><p>Cl Br</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 7 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: sec-butyl bromide 1-chloropentane</p><p>1,5-dibromohexane 1,3-dibromo-2,4-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 2,2-dichloro-3,4,-dimethylhexane 1,5-dibromo-2,4-dimethylpentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 CH3 H H H Cl CH2 Br C C C C C H CH2 H CH3 H Cl H H H C C C C H CHBr Cl H CH2 CH3 CH3 Br</p><p>Br Br (CH3)2CBrCHCH3CHClC(CH2Br)2CH3 Cl</p><p>Br Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 8 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: n-butyl bromide 2-chloropentane</p><p>1,2-dibromobutane 1,2-dibromo-3,4-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 2,4-dichloro-3,3,-dimethylhexane 3-methyl-1,2,2-tribromopentane</p><p>4. Write a correct name for each compound:</p><p>CH3 Br CHCl CH2 H H CH3 H H H H C C C C H H C C C C H Br H H H Cl H CH2 CH2Br CH2Cl</p><p>Br Cl (CH3)2CBrCH2CHCH2BrCHCH3CHClCH3 Br</p><p>Cl Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 9 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: isopropyl bromide 3-chloropentane</p><p>1,3-dibromobutane 1,4-dibromo-2,3-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 1,3-dichloro-2,2,-dimethylhexane 1,3-dibromo-2,3-dimethylpentane</p><p>4. Write a correct name for each compound:</p><p>CH2Cl CH3 Br CH3 CH2 CH2 Cl H H CH2 H CH2Cl H C C C C C H H C C C C H H Br H H H Br H CH CH3 2 CH3</p><p>Br CH2ClCH2CBrCH3C(CH3)2CHBrCH2CH3 Cl Br Cl Br</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 10 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: n-propyl bromide 1-chloroheptane</p><p>1,2-dibromohexane 2,4-dibromo-1,3-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 1,5-dichloro-2,3,-dimethylhexane 2-methyl-2,3,3-tribromopentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 Br H H H Cl CH2 H C C C C C H CH2 H CH2Cl H Br H H Br C C C C H CH2 Br H H CH3 CH2Cl</p><p>Br CH2BrCH2CBr(C2H5)CHCH2ClCH3 Cl</p><p>Br Br</p><p>Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 11 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: isobutyl bromide 2-chloroheptane</p><p>2,3-dibromohexane 1,3-dibromo-2,4-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 3,4-dichloro-2,2,-dimethylhexane 1,5-dibromo-2,4-dimethylpentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 CH3 H H H Br CH2 Br C C C C C H CH2 H CH3 H Cl H H H C C C C H CHBr CH3 Br Cl CH3 CH3</p><p>Cl (CH3)2CBrCHCH3CHClC(CH2Br)2CH3 Br Br</p><p>Cl Br</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 12 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: sec-butyl bromide 3-chloroheptane</p><p>1,3-dibromohexane 1,2-dibromo-3,4-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 2,2-dichloro-3,4,-dimethylhexane 3-methyl-1,2,2-tribromopentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 Cl CHCl CH2 H H H CH2 H CH3 H C C C C H H C C C C H H Cl H Cl H CH2 CH CH2Br 3 Br</p><p>Br Br (CH3)2CBrCH2CHCH2BrCHCH3CHClCH3 Cl</p><p>Br Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 13 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: n-butyl bromide 1-chloropentane</p><p>1,4-dibromohexane 1,4-dibromo-2,3-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 2,4-dichloro-3,3,-dimethylhexane 1,3-dibromo-2,3-dimethylpentane</p><p>4. Write a correct name for each compound:</p><p>CH2Cl Br CH3 CH2 CH2 H H CH3 Cl H H H C C C C H H C C C C C H Br H H H Br H H CH2 CH3 CH2Cl</p><p>Br Cl CH2ClCH2CBrCH3C(CH3)2CHBrCH2CH3 Br</p><p>Cl Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 14 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: isopropyl bromide 2-chloropentane</p><p>1,5-dibromohexane 2,4-dibromo-1,3-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 1,3-dichloro-2,2,-dimethylhexane 2-methyl-2,3,3-tribromopentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 Br H H H Br CH2 H C C C C C H CH2 H CH2Cl H Br H H H C C C C H CH2 H Br H CH CH2Cl 2 CH3</p><p>Br CH2BrCH2CBr(C2H5)CHCH2ClCH3 Cl Br Cl Br</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 15 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: n-propyl bromide 3-chloropentane</p><p>1,2-dibromobutane 1,3-dibromo-2,4-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 1,5-dichloro-2,3,-dimethylhexane 1,5-dibromo-2,4-dimethylpentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 CH3 H H H Cl CH2 Br C C C C C H CH2 H CH2Cl H Cl H H Br C C C C H CHBr Br H H CH3 CH3</p><p>Br (CH3)2CBrCHCH3CHClC(CH2Br)2CH3 Cl</p><p>Br Br</p><p>Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 16 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: isobutyl bromide 1-chloroheptane</p><p>1,3-dibromobutane 1,2-dibromo-3,4-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 3,4-dichloro-2,2,-dimethylhexane 3-methyl-1,2,2-tribromopentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 Br CHCl CH2 H H H CH2 H CH3 H C C C C H H C C C C H H Cl H CH3 Br Cl CH3 CH2Br</p><p>Cl (CH3)2CBrCH2CHCH2BrCHCH3CHClCH3 Br Br</p><p>Cl Br</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 17 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: sec-butyl bromide 2-chloroheptane</p><p>1,2-dibromohexane 1,4-dibromo-2,3-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 2,2-dichloro-3,4,-dimethylhexane 1,3-dibromo-2,3-dimethylpentane</p><p>4. Write a correct name for each compound:</p><p>CH2Cl CH3 Cl CH3 CH2 CH2 Cl H H CH2 H CH3 H C C C C C H H C C C C H H Br H H Cl H CH2 CH CH3 3 Br</p><p>Br Br CH2ClCH2CBrCH3C(CH3)2CHBrCH2CH3 Cl</p><p>Br Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 18 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: n-butyl bromide 3-chloroheptane</p><p>2,3-dibromohexane 2,4-dibromo-1,3-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 2,4-dichloro-3,3,-dimethylhexane 2-methyl-2,3,3-tribromopentane</p><p>4. Write a correct name for each compound:</p><p>CH3 Br Br H H H CH2 H H CH3 H C C C C C H H C C C C H H Br H H Br H H CH2 CH2 CH2Cl CH2Cl</p><p>Br Cl CH2BrCH2CBr(C2H5)CHCH2ClCH3 Br</p><p>Cl Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 19 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: isopropyl bromide 1-chloropentane</p><p>1,3-dibromohexane 1,3-dibromo-2,4-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 1,3-dichloro-2,2,-dimethylhexane 1,5-dibromo-2,4-dimethylpentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 CH3 H H H Br CH2 Br C C C C C H CH2 H CH2Cl H Cl H H H C C C C H CHBr H Br H CH CH3 2 CH3</p><p>Br (CH3)2CBrCHCH3CHClC(CH2Br)2CH3 Cl Br Cl Br</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p><p>Naming Quiz 2 - 20 Alkyl Halides</p><p>Format 15 minute quiz, 10 questions, 2 points each, 20 point total</p><p>All structures drawn as answers must show the carbon skeleton of the molecule unambiguously. Part marks may be given.</p><p>1. Draw a complete Lewis structural formula of each compound or radical: n-propyl bromide 2-chloropentane</p><p>1,4-dibromohexane 1,2-dibromo-3,4-dichlorooctane</p><p>2. Draw a condensed structural formula 3. Draw a line-angle structural of: formula of: 1,5-dichloro-2,3,-dimethylhexane 3-methyl-1,2,2-tribromopentane</p><p>4. Write a correct name for each compound:</p><p>CH3 CH3 Cl CHCl CH2 H H H CH2 H CH2Cl H C C C C H Br C C C C H H Cl H Br H H CH3 CH2Br</p><p>Br (CH3)2CBrCH2CHCH2BrCHCH3CHClCH3 Cl</p><p>Br Br</p><p>Cl</p><p>Bonus (1 point): Molecular Formula CH402 Organic Chemistry 1 Name:</p>